Products 1266778-58-8
CAS 1266778-58-8 is the registry number for Fmoc-L-Photo-Proline. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, Get quote.
(5S)-6-(9H-fluoren-9-ylmethoxycarbonyl)-1,2,6-triazaspiro[2.4]hept-1-ene-5-carboxylic acid (CAS 1266778-58-8) is a chemical compound with the molecular formula C20H17N3O4 and a molecular weight of 363.4 g/mol. IUPAC name: (5S)-6-(9H-fluoren-9-ylmethoxycarbonyl)-1,2,6-triazaspiro[2.4]hept-1-ene-5-carboxylic acid. InChIKey: BSWXCLQLAZADLK-KRWDZBQOSA-N.
| Molecular formula | C20H17N3O4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | (5S)-6-(9H-fluoren-9-ylmethoxycarbonyl)-1,2,6-triazaspiro[2.4]hept-1-ene-5-carboxylic acid |
| InChIKey | BSWXCLQLAZADLK-KRWDZBQOSA-N |
| SMILES | C1[C@H](N(CC12N=N2)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-L-Photo-Proline, orb1980238