CAS 101041-95-6 is the registry number for Org 30029 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-hydroxy-5,6-dimethoxy-1-benzothiophene-2-carboximidamide;hydrochloride (CAS 101041-95-6) is a chemical compound with the molecular formula C11H13ClN2O3S and a molecular weight of 288.75 g/mol. IUPAC name: N'-hydroxy-5,6-dimethoxy-1-benzothiophene-2-carboximidamide;hydrochloride. InChIKey: DVWBMWJOYIFITF-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3S |
|---|---|
| Molecular weight | 288.75 g/mol |
| IUPAC name | N'-hydroxy-5,6-dimethoxy-1-benzothiophene-2-carboximidamide;hydrochloride |
| InChIKey | DVWBMWJOYIFITF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(S2)/C(=N/O)/N)OC.Cl |
Computed by PubChem (NCBI)