CAS 101063-96-1 is the registry number for 3-(6-Methyl-1,1-dioxido-4H-benzo[e][1,2,4]thiadiazin-3-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(6-methyl-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)propanoic acid (CAS 101063-96-1) is a chemical compound with the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. IUPAC name: 3-(6-methyl-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)propanoic acid. InChIKey: HPBPHEGIANTPHE-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | 3-(6-methyl-1,1-dioxo-4H-1lambda6,2,4-benzothiadiazin-3-yl)propanoic acid |
| InChIKey | HPBPHEGIANTPHE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)S(=O)(=O)N=C(N2)CCC(=O)O |
Computed by PubChem (NCBI)