CAS 264225-72-1 is the registry number for Methyl 5-cyano-2-(dimethoxymethyl)-6-mercaptonicotinate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-cyano-2-(dimethoxymethyl)-6-sulfanylidene-1H-pyridine-3-carboxylate (CAS 264225-72-1) is a chemical compound with the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. IUPAC name: methyl 5-cyano-2-(dimethoxymethyl)-6-sulfanylidene-1H-pyridine-3-carboxylate. InChIKey: YBUSLWAUDLOCIR-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | methyl 5-cyano-2-(dimethoxymethyl)-6-sulfanylidene-1H-pyridine-3-carboxylate |
| InChIKey | YBUSLWAUDLOCIR-UHFFFAOYSA-N |
| SMILES | COC(C1=C(C=C(C(=S)N1)C#N)C(=O)OC)OC |
Computed by PubChem (NCBI)