Products 1092291-31-0

CAS 1092291-31-0 is the registry number for 3-[(1H-Benzimidazol-2-ylmethyl)sulfonyl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

3-(1H-benzimidazol-2-ylmethylsulfonyl)propanoic acid (CAS 1092291-31-0) is a chemical compound with the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. IUPAC name: 3-(1H-benzimidazol-2-ylmethylsulfonyl)propanoic acid. InChIKey: MCFPIFKHHQATFA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O4S
Molecular weight268.29 g/mol
IUPAC name3-(1H-benzimidazol-2-ylmethylsulfonyl)propanoic acid
InChIKeyMCFPIFKHHQATFA-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)NC(=N2)CS(=O)(=O)CCC(=O)O

Computed by PubChem (NCBI)