Products 84845-74-9
CAS 84845-74-9 is the registry number for N-(1-(Methylthio)-2-nitroethenyl)-1,3-benzodioxole-5-methanamine. Offered by: TRC. Available pack sizes: 250mg.
(Z)-N-(1,3-benzodioxol-5-ylmethyl)-1-methylsulfanyl-2-nitroethenamine (CAS 84845-74-9) is a chemical compound with the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. IUPAC name: (Z)-N-(1,3-benzodioxol-5-ylmethyl)-1-methylsulfanyl-2-nitroethenamine. InChIKey: PXZIBUPXCUYYJL-WDZFZDKYSA-N.
| Molecular formula | C11H12N2O4S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | (Z)-N-(1,3-benzodioxol-5-ylmethyl)-1-methylsulfanyl-2-nitroethenamine |
| InChIKey | PXZIBUPXCUYYJL-WDZFZDKYSA-N |
| SMILES | CS/C(=C\[N+](=O)[O-])/NCC1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)