Products 2248268-84-8
CAS 2248268-84-8 appears in our catalog under these names: 4-Cyano-5-[[(1,1-dimethylethoxy)carbonyl]amino]-2-thiophenecarboxylic acid, 97%, 5-{[(tert-butoxy)carbonyl]amino}-4-cyanothiophene-2-carboxylic acid, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
4-cyano-5-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylic acid (CAS 2248268-84-8) is a chemical compound with the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. IUPAC name: 4-cyano-5-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylic acid. InChIKey: LFRROGBSQWUQGB-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4S |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | 4-cyano-5-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylic acid |
| InChIKey | LFRROGBSQWUQGB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(S1)C(=O)O)C#N |
Computed by PubChem (NCBI)