Products 949995-11-3

CAS 949995-11-3 is the registry number for 2-((1-Oxo-1-ureidopropan-2-yl)thio)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[1-(carbamoylamino)-1-oxopropan-2-yl]sulfanylbenzoic acid (CAS 949995-11-3) is a chemical compound with the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. IUPAC name: 2-[1-(carbamoylamino)-1-oxopropan-2-yl]sulfanylbenzoic acid. InChIKey: IEDCBONQUVGJJU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O4S
Molecular weight268.29 g/mol
IUPAC name2-[1-(carbamoylamino)-1-oxopropan-2-yl]sulfanylbenzoic acid
InChIKeyIEDCBONQUVGJJU-UHFFFAOYSA-N
SMILESCC(C(=O)NC(=O)N)SC1=CC=CC=C1C(=O)O

Computed by PubChem (NCBI)