Products 1010968-81-6
CAS 1010968-81-6 is the registry number for 2-(((2,2-Dichlorocyclopropyl)methyl)thio)-6-methylpyrimidin-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-6-methylpyrimidin-4-amine (CAS 1010968-81-6) is a chemical compound with the molecular formula C9H11Cl2N3S and a molecular weight of 264.17 g/mol. IUPAC name: 2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-6-methylpyrimidin-4-amine. InChIKey: KSILWDLUQOSODF-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3S |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | 2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-6-methylpyrimidin-4-amine |
| InChIKey | KSILWDLUQOSODF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC2CC2(Cl)Cl)N |
Computed by PubChem (NCBI)