Products 2416233-97-9
CAS 2416233-97-9 appears in our catalog under these names: 2-(Chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine hydrochloride, 95%, 2-(Chloromethyl)-5,6-dimethylthieno(2,3-d)pyrimidin-4-amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine;hydrochloride (CAS 2416233-97-9) is a chemical compound with the molecular formula C9H11Cl2N3S and a molecular weight of 264.17 g/mol. IUPAC name: 2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine;hydrochloride. InChIKey: LEXKGAAOBSFNCI-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3S |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | 2-(chloromethyl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine;hydrochloride |
| InChIKey | LEXKGAAOBSFNCI-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC(=NC(=C12)N)CCl)C.Cl |
Computed by PubChem (NCBI)