CAS 2155852-54-1 is the registry number for 4-Methyl-5-(pyridin-2-yl)-1,3-thiazol-2-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-methyl-5-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride (CAS 2155852-54-1) is a chemical compound with the molecular formula C9H11Cl2N3S and a molecular weight of 264.17 g/mol. IUPAC name: 4-methyl-5-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride. InChIKey: KCJDYCLFSTWJDZ-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3S |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | 4-methyl-5-pyridin-2-yl-1,3-thiazol-2-amine;dihydrochloride |
| InChIKey | KCJDYCLFSTWJDZ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)C2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)