CAS 1240528-34-0 is the registry number for (4-(Pyridin-4-yl)-1,3-thiazol-2-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-pyridin-4-yl-1,3-thiazol-2-yl)methanamine;dihydrochloride (CAS 1240528-34-0) is a chemical compound with the molecular formula C9H11Cl2N3S and a molecular weight of 264.17 g/mol. IUPAC name: (4-pyridin-4-yl-1,3-thiazol-2-yl)methanamine;dihydrochloride. InChIKey: GYFCYDWRFJBIIK-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3S |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | (4-pyridin-4-yl-1,3-thiazol-2-yl)methanamine;dihydrochloride |
| InChIKey | GYFCYDWRFJBIIK-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CSC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)