CAS 1152584-89-8 appears in our catalog under these names: 3-Amino-1-(1-(2,4-dichlorophenyl)ethyl)thiourea, 95%, 3-Amino-1-(1-(2,4-dichlorophenyl)ethyl)thiourea. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-amino-3-[1-(2,4-dichlorophenyl)ethyl]thiourea (CAS 1152584-89-8) is a chemical compound with the molecular formula C9H11Cl2N3S and a molecular weight of 264.17 g/mol. IUPAC name: 1-amino-3-[1-(2,4-dichlorophenyl)ethyl]thiourea. InChIKey: YKOQAYBRGFQIDN-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3S |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | 1-amino-3-[1-(2,4-dichlorophenyl)ethyl]thiourea |
| InChIKey | YKOQAYBRGFQIDN-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)Cl)Cl)NC(=S)NN |
Computed by PubChem (NCBI)