CAS 1955541-32-8 is the registry number for (4-(Pyridin-2-yl)-1,3-thiazol-2-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4-pyridin-2-yl-1,3-thiazol-2-yl)methanamine;dihydrochloride (CAS 1955541-32-8) is a chemical compound with the molecular formula C9H11Cl2N3S and a molecular weight of 264.17 g/mol. IUPAC name: (4-pyridin-2-yl-1,3-thiazol-2-yl)methanamine;dihydrochloride. InChIKey: GAPFBRJGQAUDRU-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3S |
|---|---|
| Molecular weight | 264.17 g/mol |
| IUPAC name | (4-pyridin-2-yl-1,3-thiazol-2-yl)methanamine;dihydrochloride |
| InChIKey | GAPFBRJGQAUDRU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CSC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)