Products 1011-92-3
CAS 1011-92-3 appears in our catalog under these names: 2-Cyano-3-phenylacrylic acid 95%, 2-Cyano-3-Phenylacrylic Acid, 98%, 98%, Alpha-cyanocinnamic acid, 98%, alpha–Cyanocinnamic Acid, alpha-Cyanocinnamic Acid, >98.0%(HPLC)(T). Offered by: Ambeed, Chemat, Combi-blocks, GLPBio, TCI. Available pack sizes: 1g, 5g, 25g, 250mg, 100g, 50g, 250g.
(E)-2-cyano-3-phenylprop-2-enoic acid (CAS 1011-92-3) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: (E)-2-cyano-3-phenylprop-2-enoic acid. InChIKey: CDUQMGQIHYISOP-RMKNXTFCSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (E)-2-cyano-3-phenylprop-2-enoic acid |
| InChIKey | CDUQMGQIHYISOP-RMKNXTFCSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(\C#N)/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
alpha-Cyanocinnamate, (E)-2-cyano-3-phenylprop-2-enoic acid, alpha-Cyanocinnamic acid, 2-Cyano-3-phenylacrylic Acid, 2-Propenoic acid, 2-cyano-3-phenyl-, (E)-2-Cyano-3-phenylacrylic acid, 2-cyano-3-phenylprop-2-enoic acid, (2E)-2-cyano-3-phenylprop-2-enoic acid, (2E)-2-cyano-3-phenylacrylic acid, 2-propenoic acid, 2-cyano-3-phenyl-, (2E)-