Products 1011301-80-6

CAS 1011301-80-6 is the registry number for Methyl 6-Phenyl-5-(p-tolyl)picolinate. Offered by: TRC, Biosynth. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Methyl 5-(4-methylphenyl)-6-phenylpyridine-2-carboxylate (CAS 1011301-80-6) is a chemical compound with the molecular formula C20H17NO2 and a molecular weight of 303.4 g/mol. IUPAC name: methyl 5-(4-methylphenyl)-6-phenylpyridine-2-carboxylate. InChIKey: HHTJSCIRSQCPEX-UHFFFAOYSA-N.

Identity
Molecular formulaC20H17NO2
Molecular weight303.4 g/mol
IUPAC namemethyl 5-(4-methylphenyl)-6-phenylpyridine-2-carboxylate
InChIKeyHHTJSCIRSQCPEX-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=C(N=C(C=C2)C(=O)OC)C3=CC=CC=C3

Computed by PubChem (NCBI)