Products 2628508-65-4
CAS 2628508-65-4 is the registry number for 2-Methoxy-6-(2-methyl-[1,1'-biphenyl]-3-yl)nicotinaldehyde, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 250mg, 1g.
2-methoxy-6-(2-methyl-3-phenylphenyl)pyridine-3-carbaldehyde (CAS 2628508-65-4) is a chemical compound with the molecular formula C20H17NO2 and a molecular weight of 303.4 g/mol. IUPAC name: 2-methoxy-6-(2-methyl-3-phenylphenyl)pyridine-3-carbaldehyde. InChIKey: SVSQERSZIKTRTR-UHFFFAOYSA-N.
| Molecular formula | C20H17NO2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 2-methoxy-6-(2-methyl-3-phenylphenyl)pyridine-3-carbaldehyde |
| InChIKey | SVSQERSZIKTRTR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C2=NC(=C(C=C2)C=O)OC)C3=CC=CC=C3 |
Computed by PubChem (NCBI)