Products 25069-30-1
CAS 25069-30-1 is the registry number for Methyl 4-(diphenylamino)benzoate, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-(N-phenylanilino)benzoate (CAS 25069-30-1) is a chemical compound with the molecular formula C20H17NO2 and a molecular weight of 303.4 g/mol. IUPAC name: methyl 4-(N-phenylanilino)benzoate. InChIKey: LMPDKTVEQHXQKW-UHFFFAOYSA-N.
| Molecular formula | C20H17NO2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | methyl 4-(N-phenylanilino)benzoate |
| InChIKey | LMPDKTVEQHXQKW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)