CAS 409345-76-2 appears in our catalog under these names: 1-(3,4-Dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-phenylethanone, 97%, R214127. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 25mg, 100mg.
1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-phenylethanone (CAS 409345-76-2) is a chemical compound with the molecular formula C20H17NO2 and a molecular weight of 303.4 g/mol. IUPAC name: 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-phenylethanone. InChIKey: HXUSRWUBSYSWII-UHFFFAOYSA-N.
| Molecular formula | C20H17NO2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 1-(3,4-dihydro-2H-pyrano[2,3-b]quinolin-7-yl)-2-phenylethanone |
| InChIKey | HXUSRWUBSYSWII-UHFFFAOYSA-N |
| SMILES | C1CC2=C(N=C3C=CC(=CC3=C2)C(=O)CC4=CC=CC=C4)OC1 |
Computed by PubChem (NCBI)