Products 1286261-77-5

CAS 1286261-77-5 is the registry number for 4'-Methoxy-N-phenyl-(1,1'-biphenyl)-2-carboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-(4-methoxyphenyl)-N-phenylbenzamide (CAS 1286261-77-5) is a chemical compound with the molecular formula C20H17NO2 and a molecular weight of 303.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-N-phenylbenzamide. InChIKey: OOIWZBIPTINHIL-UHFFFAOYSA-N.

Identity
Molecular formulaC20H17NO2
Molecular weight303.4 g/mol
IUPAC name2-(4-methoxyphenyl)-N-phenylbenzamide
InChIKeyOOIWZBIPTINHIL-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=CC=CC=C2C(=O)NC3=CC=CC=C3

Computed by PubChem (NCBI)