Products 1022580-78-4
CAS 1022580-78-4 is the registry number for 2-((6-methyl-1,2,3,4-tetrahydroquinolyl)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methylidene]indene-1,3-dione (CAS 1022580-78-4) is a chemical compound with the molecular formula C20H17NO2 and a molecular weight of 303.4 g/mol. IUPAC name: 2-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methylidene]indene-1,3-dione. InChIKey: XQLUSRHNQAPKJI-UHFFFAOYSA-N.
| Molecular formula | C20H17NO2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 2-[(6-methyl-3,4-dihydro-2H-quinolin-1-yl)methylidene]indene-1,3-dione |
| InChIKey | XQLUSRHNQAPKJI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(CCC2)C=C3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)