Products 101162-42-9
CAS 101162-42-9 appears in our catalog under these names: Ibudilast Impurity 1, 6,7-Dihydrodiol-ibudilast. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-(6,7-dihydroxy-2-propan-2-yl-6,7-dihydropyrazolo[1,5-a]pyridin-3-yl)-2-methylpropan-1-one (CAS 101162-42-9) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: 1-(6,7-dihydroxy-2-propan-2-yl-6,7-dihydropyrazolo[1,5-a]pyridin-3-yl)-2-methylpropan-1-one. InChIKey: IPCRPIMYUQUART-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O3 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 1-(6,7-dihydroxy-2-propan-2-yl-6,7-dihydropyrazolo[1,5-a]pyridin-3-yl)-2-methylpropan-1-one |
| InChIKey | IPCRPIMYUQUART-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN2C(C(C=CC2=C1C(=O)C(C)C)O)O |
Computed by PubChem (NCBI)