CAS 1012081-63-8 is the registry number for Methyl 1-(pyridin-3-yl)-1H-1,2,3-triazole-4-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 1-pyridin-3-yltriazole-4-carboxylate (CAS 1012081-63-8) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: methyl 1-pyridin-3-yltriazole-4-carboxylate. InChIKey: JTRZBOODLNEROC-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | methyl 1-pyridin-3-yltriazole-4-carboxylate |
| InChIKey | JTRZBOODLNEROC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN(N=N1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)