Products 101219-61-8
CAS 101219-61-8 is the registry number for Picrasidine Q. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg.
4-hydroxy-3-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one (CAS 101219-61-8) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 4-hydroxy-3-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one. InChIKey: HJFNTSGIQCFHGP-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 4-hydroxy-3-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
| InChIKey | HJFNTSGIQCFHGP-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=NC=CC3=C2N(C1=O)C4=CC=CC=C34)O |
Computed by PubChem (NCBI)