CAS 101351-60-4 is the registry number for Olsalazine Dimethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 2-hydroxy-5-[(4-hydroxy-3-methoxycarbonylphenyl)diazenyl]benzoate (CAS 101351-60-4) is a chemical compound with the molecular formula C16H14N2O6 and a molecular weight of 330.29 g/mol. IUPAC name: methyl 2-hydroxy-5-[(4-hydroxy-3-methoxycarbonylphenyl)diazenyl]benzoate. InChIKey: UZCNQYSIBOPVEF-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O6 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | methyl 2-hydroxy-5-[(4-hydroxy-3-methoxycarbonylphenyl)diazenyl]benzoate |
| InChIKey | UZCNQYSIBOPVEF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N=NC2=CC(=C(C=C2)O)C(=O)OC)O |
Computed by PubChem (NCBI)