Products 101351-60-4

CAS 101351-60-4 is the registry number for Olsalazine Dimethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Methyl 2-hydroxy-5-[(4-hydroxy-3-methoxycarbonylphenyl)diazenyl]benzoate (CAS 101351-60-4) is a chemical compound with the molecular formula C16H14N2O6 and a molecular weight of 330.29 g/mol. IUPAC name: methyl 2-hydroxy-5-[(4-hydroxy-3-methoxycarbonylphenyl)diazenyl]benzoate. InChIKey: UZCNQYSIBOPVEF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14N2O6
Molecular weight330.29 g/mol
IUPAC namemethyl 2-hydroxy-5-[(4-hydroxy-3-methoxycarbonylphenyl)diazenyl]benzoate
InChIKeyUZCNQYSIBOPVEF-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC(=C1)N=NC2=CC(=C(C=C2)O)C(=O)OC)O

Computed by PubChem (NCBI)