CAS 166442-40-6 is the registry number for 2’-Carboxy-4-dimethylamino-2-hydroxy-5’-nitrobenzophenone. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
2-[4-(dimethylamino)-2-hydroxybenzoyl]-4-nitrobenzoic acid (CAS 166442-40-6) is a chemical compound with the molecular formula C16H14N2O6 and a molecular weight of 330.29 g/mol. IUPAC name: 2-[4-(dimethylamino)-2-hydroxybenzoyl]-4-nitrobenzoic acid. InChIKey: ISSFRVNVTUDNLA-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O6 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 2-[4-(dimethylamino)-2-hydroxybenzoyl]-4-nitrobenzoic acid |
| InChIKey | ISSFRVNVTUDNLA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])C(=O)O)O |
Computed by PubChem (NCBI)