Products 73372-63-1

CAS 73372-63-1 is the registry number for Nifedipine Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.

5-methoxycarbonyl-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylic acid (CAS 73372-63-1) is a chemical compound with the molecular formula C16H14N2O6 and a molecular weight of 330.29 g/mol. IUPAC name: 5-methoxycarbonyl-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylic acid. InChIKey: LCCVJQVUSQPANR-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14N2O6
Molecular weight330.29 g/mol
IUPAC name5-methoxycarbonyl-2,6-dimethyl-4-(2-nitrophenyl)pyridine-3-carboxylic acid
InChIKeyLCCVJQVUSQPANR-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=N1)C)C(=O)OC)C2=CC=CC=C2[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)