Products 2229976-20-7

CAS 2229976-20-7 is the registry number for 3-(2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)propanoic acid 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanoic acid (CAS 2229976-20-7) is a chemical compound with the molecular formula C16H14N2O6 and a molecular weight of 330.29 g/mol. IUPAC name: 3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanoic acid. InChIKey: GVBLLJRGNGJTDK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14N2O6
Molecular weight330.29 g/mol
IUPAC name3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propanoic acid
InChIKeyGVBLLJRGNGJTDK-UHFFFAOYSA-N
SMILESC1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC(=C3C2=O)CCC(=O)O

Computed by PubChem (NCBI)