CAS 2426-62-2 is the registry number for 2-(Benzyloxy)-3-methoxy-Beta,6-dinitrostyrene. Offered by: TRC. Available pack sizes: 250mg, 25mg.
1-methoxy-4-nitro-3-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene (CAS 2426-62-2) is a chemical compound with the molecular formula C16H14N2O6 and a molecular weight of 330.29 g/mol. IUPAC name: 1-methoxy-4-nitro-3-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene. InChIKey: FIMFMXZSFUHXQJ-MDZDMXLPSA-N.
| Molecular formula | C16H14N2O6 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 1-methoxy-4-nitro-3-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene |
| InChIKey | FIMFMXZSFUHXQJ-MDZDMXLPSA-N |
| SMILES | COC1=C(C(=C(C=C1)[N+](=O)[O-])/C=C/[N+](=O)[O-])OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)