CAS 64603-72-1 appears in our catalog under these names: Nicardipine Related Compound 2, Benidipine Impurity I, Nifedipine Impurity 38, Nicardipine Impurity 4, 2,6-Dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylic acid monomethyl ester. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid (CAS 64603-72-1) is a chemical compound with the molecular formula C16H14N2O6 and a molecular weight of 330.29 g/mol. IUPAC name: 5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid. InChIKey: BXLPPWLKFWCWOY-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O6 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid |
| InChIKey | BXLPPWLKFWCWOY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)