CAS 1013620-98-8 is the registry number for ST13. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-acetamido-N-(2-hydroxy-5-phenylphenyl)benzamide (CAS 1013620-98-8) is a chemical compound with the molecular formula C21H18N2O3 and a molecular weight of 346.4 g/mol. IUPAC name: 4-acetamido-N-(2-hydroxy-5-phenylphenyl)benzamide. InChIKey: XTYGZPBJDVNICY-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O3 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 4-acetamido-N-(2-hydroxy-5-phenylphenyl)benzamide |
| InChIKey | XTYGZPBJDVNICY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C(=O)NC2=C(C=CC(=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)