CAS 203256-20-6 appears in our catalog under these names: DACB-CN, 4-(7-Diethylaminocoumarin-3-yl)benzoyl cyanide. Offered by: Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, Get quote.
4-[7-(diethylamino)-2-oxochromen-3-yl]benzoyl cyanide (CAS 203256-20-6) is a chemical compound with the molecular formula C21H18N2O3 and a molecular weight of 346.4 g/mol. IUPAC name: 4-[7-(diethylamino)-2-oxochromen-3-yl]benzoyl cyanide. InChIKey: SWWHUDUIQPNVFF-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O3 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 4-[7-(diethylamino)-2-oxochromen-3-yl]benzoyl cyanide |
| InChIKey | SWWHUDUIQPNVFF-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C3=CC=C(C=C3)C(=O)C#N |
Computed by PubChem (NCBI)