Products 371213-22-8
CAS 371213-22-8 appears in our catalog under these names: WAY-297629, ≥98%, ≥98%, VEGFR-2-IN-65. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, Get quote.
2-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]naphthalen-1-ol (CAS 371213-22-8) is a chemical compound with the molecular formula C21H18N2O3 and a molecular weight of 346.4 g/mol. IUPAC name: 2-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]naphthalen-1-ol. InChIKey: ICXLGEZBHYTHDQ-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O3 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2-[3-(3,4-dimethoxyphenyl)-1H-pyrazol-5-yl]naphthalen-1-ol |
| InChIKey | ICXLGEZBHYTHDQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NNC(=C2)C3=C(C4=CC=CC=C4C=C3)O)OC |
Computed by PubChem (NCBI)