CAS 249762-74-1 appears in our catalog under these names: 2-(1H-Indole-2-carbonyl)-1H-indol-5-yl butyrate, 95%, PDGFR Tyrosine Kinase Inhibi 1PC X 1MG, D-65476. Offered by: Chemat Brand, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 1MG, Get quote.
[2-(1H-indole-2-carbonyl)-1H-indol-5-yl] butanoate (CAS 249762-74-1) is a chemical compound with the molecular formula C21H18N2O3 and a molecular weight of 346.4 g/mol. IUPAC name: [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] butanoate. InChIKey: CZDUJGOCEPWCNA-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O3 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | [2-(1H-indole-2-carbonyl)-1H-indol-5-yl] butanoate |
| InChIKey | CZDUJGOCEPWCNA-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=CC2=C(C=C1)NC(=C2)C(=O)C3=CC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)