CAS 206983-16-6 is the registry number for 3-(4-methoxyphenyl)-1-(2-methylpropanoyl)indeno(2,3-d)pyrazol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-methoxyphenyl)-1-(2-methylpropanoyl)indeno[2,1-d]pyrazol-4-one (CAS 206983-16-6) is a chemical compound with the molecular formula C21H18N2O3 and a molecular weight of 346.4 g/mol. IUPAC name: 3-(4-methoxyphenyl)-1-(2-methylpropanoyl)indeno[2,1-d]pyrazol-4-one. InChIKey: UIXJCRWYVWKNKZ-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O3 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-1-(2-methylpropanoyl)indeno[2,1-d]pyrazol-4-one |
| InChIKey | UIXJCRWYVWKNKZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)N1C2=C(C(=N1)C3=CC=C(C=C3)OC)C(=O)C4=CC=CC=C42 |
Computed by PubChem (NCBI)