CAS 316131-42-7 is the registry number for 2-Hydroxy-2-((3-(phenylmethoxy)phenyl)methylene) Hydrazide Benzoic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-hydroxy-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]benzamide (CAS 316131-42-7) is a chemical compound with the molecular formula C21H18N2O3 and a molecular weight of 346.4 g/mol. IUPAC name: 2-hydroxy-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]benzamide. InChIKey: KZQVVVKGPPAFHG-HYARGMPZSA-N.
| Molecular formula | C21H18N2O3 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2-hydroxy-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]benzamide |
| InChIKey | KZQVVVKGPPAFHG-HYARGMPZSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)/C=N/NC(=O)C3=CC=CC=C3O |
Computed by PubChem (NCBI)