CAS 1014-25-1 appears in our catalog under these names: 2–Amino–5–(4–methoxyphenyl)–1,3,4–thiadiazole, 5-(4-Methoxyphenyl)-1,3,4-thiadiazol-2-amine, >95.0%(HPLC)(T), 5-(4-Methoxyphenyl)-1,3,4-thiadiazol-2-amine, 95%, 95%, 5-(4-Methoxy-phenyl)-[1,3,4]thiadiazol-2-ylamine, 98%, 5-(4-Methoxyphenyl)-1,3,4-thiadiazol-2-amine, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 250mg, 10g.
5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine (CAS 1014-25-1) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: UJBCFMCQLVRXBQ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | UJBCFMCQLVRXBQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NN=C(S2)N |
Computed by PubChem (NCBI)