Products 101420-62-6
CAS 101420-62-6 appears in our catalog under these names: 5-Chloropyridine-3,4-dicarboxylic acid, 95%, 3,4-Pyridinedicarboxylic acid, 5-chloro-, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-chloropyridine-3,4-dicarboxylic acid (CAS 101420-62-6) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 5-chloropyridine-3,4-dicarboxylic acid. InChIKey: ZUGJYIOPGDYHRX-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 5-chloropyridine-3,4-dicarboxylic acid |
| InChIKey | ZUGJYIOPGDYHRX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)