CAS 1014632-18-8 appears in our catalog under these names: 1–(Pyrimidin–2–yl)–1H–pyrazole–4–carboxylic acid, 1-(Pyrimidin-2-yl)-1H-pyrazole-4-carboxylic acid, 95%, 95%, 1-(Pyrimidin-2-yl)-1H-pyrazole-4-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-pyrimidin-2-ylpyrazole-4-carboxylic acid (CAS 1014632-18-8) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 1-pyrimidin-2-ylpyrazole-4-carboxylic acid. InChIKey: IPLDZENGFJONBV-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 1-pyrimidin-2-ylpyrazole-4-carboxylic acid |
| InChIKey | IPLDZENGFJONBV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)N2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)