CAS 1015070-54-8 appears in our catalog under these names: 1-(Isoquinolin-6-yl)ethanone, 98%, 1-(6-Isoquinolinyl)ethanone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 250mg, 1g, 5g, 50mg, 0,5g.
1-isoquinolin-6-ylethanone (CAS 1015070-54-8) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 1-isoquinolin-6-ylethanone. InChIKey: BKFUTIVUUBJCIS-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 1-isoquinolin-6-ylethanone |
| InChIKey | BKFUTIVUUBJCIS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=NC=C2 |
Computed by PubChem (NCBI)