CAS 101513-80-8 appears in our catalog under these names: 3-Chloro-2,4,5-trifluorobenzaldehyde 85%, 3-chloro-2,4,5-trifluorobenzaldehyde, 85%, 85%, 3-Chloro-2,4,5-trifluorobenzaldehyde, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-2,4,5-trifluorobenzaldehyde (CAS 101513-80-8) is a chemical compound with the molecular formula C7H2ClF3O and a molecular weight of 194.54 g/mol. IUPAC name: 3-chloro-2,4,5-trifluorobenzaldehyde. InChIKey: FNOTUPISSVMOCU-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3O |
|---|---|
| Molecular weight | 194.54 g/mol |
| IUPAC name | 3-chloro-2,4,5-trifluorobenzaldehyde |
| InChIKey | FNOTUPISSVMOCU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Cl)F)C=O |
Computed by PubChem (NCBI)