CAS 101513-93-3 is the registry number for 5-Chloro-2,3,4-trifluorobenzaldehyde, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-chloro-2,3,4-trifluorobenzaldehyde (CAS 101513-93-3) is a chemical compound with the molecular formula C7H2ClF3O and a molecular weight of 194.54 g/mol. IUPAC name: 5-chloro-2,3,4-trifluorobenzaldehyde. InChIKey: FLFHKEPFQPBDPK-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3O |
|---|---|
| Molecular weight | 194.54 g/mol |
| IUPAC name | 5-chloro-2,3,4-trifluorobenzaldehyde |
| InChIKey | FLFHKEPFQPBDPK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)F)F)F)C=O |
Computed by PubChem (NCBI)