CAS 177787-26-7 appears in our catalog under these names: 3,4,5-Trifluorobenzoyl chloride, 95%, 3,4,5–Trifluorobenzoyl chloride, 3,4,5-trifluorobenzoylchloride 95%, 3,4,5-Trifluorobenzoyl chloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 100g, 250mg.
3,4,5-trifluorobenzoyl chloride (CAS 177787-26-7) is a chemical compound with the molecular formula C7H2ClF3O and a molecular weight of 194.54 g/mol. IUPAC name: 3,4,5-trifluorobenzoyl chloride. InChIKey: YRUNCQNKZIQTEO-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3O |
|---|---|
| Molecular weight | 194.54 g/mol |
| IUPAC name | 3,4,5-trifluorobenzoyl chloride |
| InChIKey | YRUNCQNKZIQTEO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C(=O)Cl |
Computed by PubChem (NCBI)