CAS 189807-20-3 appears in our catalog under these names: 2,3,6-Trifluorobenzoyl chloride, 95%, 2,3,6-trifluorobenzoylchloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
2,3,6-trifluorobenzoyl chloride (CAS 189807-20-3) is a chemical compound with the molecular formula C7H2ClF3O and a molecular weight of 194.54 g/mol. IUPAC name: 2,3,6-trifluorobenzoyl chloride. InChIKey: DMUGJQMADYEWSQ-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3O |
|---|---|
| Molecular weight | 194.54 g/mol |
| IUPAC name | 2,3,6-trifluorobenzoyl chloride |
| InChIKey | DMUGJQMADYEWSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)Cl)F)F |
Computed by PubChem (NCBI)