Products 1015584-63-0
CAS 1015584-63-0 is the registry number for 2-Methyl-1-oxo-1H,2H,3H,4H,9H-pyrido(3,4-b)indole-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methyl-1-oxo-4,9-dihydro-3H-pyrido[3,4-b]indole-6-carboxylic acid (CAS 1015584-63-0) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 2-methyl-1-oxo-4,9-dihydro-3H-pyrido[3,4-b]indole-6-carboxylic acid. InChIKey: IRKOTZQGJJYXIW-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 2-methyl-1-oxo-4,9-dihydro-3H-pyrido[3,4-b]indole-6-carboxylic acid |
| InChIKey | IRKOTZQGJJYXIW-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1=O)NC3=C2C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)