Products 1015780-05-8
CAS 1015780-05-8 is the registry number for Ethyl 2-(5-chloro-3-methyl-1H-pyrazol-1-yl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 2-(5-chloro-3-methylpyrazol-1-yl)acetate (CAS 1015780-05-8) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: ethyl 2-(5-chloro-3-methylpyrazol-1-yl)acetate. InChIKey: IVDWRSMHUUIEPI-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | ethyl 2-(5-chloro-3-methylpyrazol-1-yl)acetate |
| InChIKey | IVDWRSMHUUIEPI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=CC(=N1)C)Cl |
Computed by PubChem (NCBI)