Products 112600-92-7
CAS 112600-92-7 appears in our catalog under these names: Pidotimod Impurity 23(L-Pyroglutamic Acid Dimer), L-Pyroglutamic Acid Dimer, 1-L-Pyroglutamyl-L-pyroglutamic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(2S)-5-oxo-1-[(2S)-5-oxopyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid (CAS 112600-92-7) is a chemical compound with the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. IUPAC name: (2S)-5-oxo-1-[(2S)-5-oxopyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid. InChIKey: LGVSGLWADQKMKV-WDSKDSINSA-N.
| Molecular formula | C10H12N2O5 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | (2S)-5-oxo-1-[(2S)-5-oxopyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | LGVSGLWADQKMKV-WDSKDSINSA-N |
| SMILES | C1CC(=O)N[C@@H]1C(=O)N2[C@@H](CCC2=O)C(=O)O |
Computed by PubChem (NCBI)