CAS 1016684-14-2 appears in our catalog under these names: 5-((2-Fluorophenyl)methyl)-1,3,4-oxadiazol-2-amine, 5-[(2-Fluorophenyl)methyl]-1,3,4-oxadiazol-2-amine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 250mg, 2,5g, 1g.
5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-amine (CAS 1016684-14-2) is a chemical compound with the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. IUPAC name: 5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-amine. InChIKey: NOTAHFVAQOJMKW-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3O |
|---|---|
| Molecular weight | 193.18 g/mol |
| IUPAC name | 5-[(2-fluorophenyl)methyl]-1,3,4-oxadiazol-2-amine |
| InChIKey | NOTAHFVAQOJMKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NN=C(O2)N)F |
Computed by PubChem (NCBI)