CAS 2226974-16-7 is the registry number for (5-(2-Fluorophenyl)-1H-1,2,4-triazol-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol (CAS 2226974-16-7) is a chemical compound with the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. IUPAC name: [3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol. InChIKey: XGKWTJMJGMOSFT-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3O |
|---|---|
| Molecular weight | 193.18 g/mol |
| IUPAC name | [3-(2-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanol |
| InChIKey | XGKWTJMJGMOSFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=N2)CO)F |
Computed by PubChem (NCBI)