Products 97096-91-8
CAS 97096-91-8 is the registry number for 5-Amino-2-(2-fluorophenyl)-2,4-dihydro-3h-pyrazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-amino-2-(2-fluorophenyl)-4H-pyrazol-3-one (CAS 97096-91-8) is a chemical compound with the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. IUPAC name: 5-amino-2-(2-fluorophenyl)-4H-pyrazol-3-one. InChIKey: QLTKJQFHICGITB-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3O |
|---|---|
| Molecular weight | 193.18 g/mol |
| IUPAC name | 5-amino-2-(2-fluorophenyl)-4H-pyrazol-3-one |
| InChIKey | QLTKJQFHICGITB-UHFFFAOYSA-N |
| SMILES | C1C(=NN(C1=O)C2=CC=CC=C2F)N |
Computed by PubChem (NCBI)